C10H18N2O2S — CID 134550002
(3Z,5E)-N-methyl-5-(methylaminomethyl)hepta-1,3,5-triene-2-sulfonamide (PubChem CID 134550002) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is (3Z,5E)-N-methyl-5-(methylaminomethyl)hepta-1,3,5-triene-2-sulfonamide.
| Compound Name | (3Z,5E)-N-methyl-5-(methylaminomethyl)hepta-1,3,5-triene-2-sulfonamide |
|---|---|
| PubChem CID | 134550002 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3Z,5E)-N-methyl-5-(methylaminomethyl)hepta-1,3,5-triene-2-sulfonamide |
| SMILES | C=C(/C=C\C(=C/C)CNC)S(=O)(=O)NC |
| InChI | InChI=1S/C10H18N2O2S/c1-5-10(8-11-3)7-6-9(2)15(13,14)12-4/h5-7,11-12H,2,8H2,1,3-4H3/b7-6-,10-5+ |
| InChIKey | JITHXYAOJZCBSL-JQEGGOPCSA-N |
| XLogP | 0.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|