C10H19NO2S — CID 123409379
N-(2-methylidenepent-3-enyl)butane-2-sulfonamide (PubChem CID 123409379) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(2-methylidenepent-3-enyl)butane-2-sulfonamide.
| Compound Name | N-(2-methylidenepent-3-enyl)butane-2-sulfonamide |
|---|---|
| PubChem CID | 123409379 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-methylidenepent-3-enyl)butane-2-sulfonamide |
| SMILES | C=C(C=CC)CNS(=O)(=O)C(C)CC |
| InChI | InChI=1S/C10H19NO2S/c1-5-7-9(3)8-11-14(12,13)10(4)6-2/h5,7,10-11H,3,6,8H2,1-2,4H3 |
| InChIKey | IMRWOURKGAMFIN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|