C34H55NO2S2 — CID 146731445
[4-(4-pentylcyclohexyl)cyclohexyl]methyl 2-cyano-2-[5-(4-propylcyclohexyl)-1,3-dithian-2-ylidene]acetate (PubChem CID 146731445) has the molecular formula C34H55NO2S2 and a molecular weight of 573.95 g/mol. Its IUPAC name is [4-(4-pentylcyclohexyl)cyclohexyl]methyl 2-cyano-2-[5-(4-propylcyclohexyl)-1,3-dithian-2-ylidene]acetate.
| Compound Name | [4-(4-pentylcyclohexyl)cyclohexyl]methyl 2-cyano-2-[5-(4-propylcyclohexyl)-1,3-dithian-2-ylidene]acetate |
|---|---|
| PubChem CID | 146731445 |
| Molecular Formula | C34H55NO2S2 |
| Molecular Weight | 573.95 g/mol |
| Exact Mass | 573.37 |
| IUPAC Name | [4-(4-pentylcyclohexyl)cyclohexyl]methyl 2-cyano-2-[5-(4-propylcyclohexyl)-1,3-dithian-2-ylidene]acetate |
| SMILES | CCCCCC1CCC(C2CCC(COC(=O)C(C#N)=C3SCC(C4CCC(CCC)CC4)CS3)CC2)CC1 |
| InChI | InChI=1S/C34H55NO2S2/c1-3-5-6-8-26-11-15-28(16-12-26)29-19-13-27(14-20-29)22-37-33(36)32(21-35)34-38-23-31(24-39-34)30-17-9-25(7-4-2)10-18-30/h25-31H,3-20,22-24H2,1-2H3/b34-32- |
| InChIKey | RIBCRDUTNZDPGZ-YJKCNMNRSA-N |
| XLogP | 10.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.95 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|