C34H45F2NO2S2 — CID 143189183
[4-(4-methylcyclohexyl)cyclohexyl] (2Z)-2-cyano-2-[4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolan-2-ylidene]acetate (PubChem CID 143189183) has the molecular formula C34H45F2NO2S2 and a molecular weight of 601.87 g/mol. Its IUPAC name is [4-(4-methylcyclohexyl)cyclohexyl] (2Z)-2-cyano-2-[4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolan-2-ylidene]acetate.
| Compound Name | [4-(4-methylcyclohexyl)cyclohexyl] (2Z)-2-cyano-2-[4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 143189183 |
| Molecular Formula | C34H45F2NO2S2 |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | [4-(4-methylcyclohexyl)cyclohexyl] (2Z)-2-cyano-2-[4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolan-2-ylidene]acetate |
| SMILES | CCCC1CCC(c2cc(F)c(C3CS/C(=C(\C#N)C(=O)OC4CCC(C5CCC(C)CC5)CC4)S3)c(F)c2)CC1 |
| InChI | InChI=1S/C34H45F2NO2S2/c1-3-4-22-7-11-25(12-8-22)26-17-29(35)32(30(36)18-26)31-20-40-34(41-31)28(19-37)33(38)39-27-15-13-24(14-16-27)23-9-5-21(2)6-10-23/h17-18,21-25,27,31H,3-16,20H2,1-2H3/b34-28- |
| InChIKey | UILVJRUDAOZCPD-BFYITVNDSA-N |
| XLogP | 10.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|