C43H67F2NO2S2 — CID 143189142
4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolane;2-formylprop-2-enenitrile;1-heptyl-4-(4-methoxycyclohexyl)cycloheptane (PubChem CID 143189142) has the molecular formula C43H67F2NO2S2 and a molecular weight of 732.14 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolane;2-formylprop-2-enenitrile;1-heptyl-4-(4-methoxycyclohexyl)cycloheptane.
| Compound Name | 4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolane;2-formylprop-2-enenitrile;1-heptyl-4-(4-methoxycyclohexyl)cycloheptane |
|---|---|
| PubChem CID | 143189142 |
| Molecular Formula | C43H67F2NO2S2 |
| Molecular Weight | 732.14 g/mol |
| Exact Mass | 731.46 |
| IUPAC Name | 4-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-1,3-dithiolane;2-formylprop-2-enenitrile;1-heptyl-4-(4-methoxycyclohexyl)cycloheptane |
| SMILES | C=C(C#N)C=O.CCCC1CCC(c2cc(F)c(C3CSCS3)c(F)c2)CC1.CCCCCCCC1CCCC(C2CCC(OC)CC2)CC1 |
| InChI | InChI=1S/C21H40O.C18H24F2S2.C4H3NO/c1-3-4-5-6-7-9-18-10-8-11-19(13-12-18)20-14-16-21(22-2)17-15-20;1-2-3-12-4-6-13(7-5-12)14-8-15(19)18(16(20)9-14)17-10-21-11-22-17;1-4(2-5)3-6/h18-21H,3-17H2,1-2H3;8-9,12-13,17H,2-7,10-11H2,1H3;3H,1H2 |
| InChIKey | AYNNQWMRVGFYHF-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.14 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|