C18H16O5S — CID 14673573
5,6-dimethoxy-3-phenylmethoxy-1-benzothiophene-2-carboxylic acid (PubChem CID 14673573) has the molecular formula C18H16O5S and a molecular weight of 344.39 g/mol. Its IUPAC name is 5,6-dimethoxy-3-phenylmethoxy-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5,6-dimethoxy-3-phenylmethoxy-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 14673573 |
| Molecular Formula | C18H16O5S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5,6-dimethoxy-3-phenylmethoxy-1-benzothiophene-2-carboxylic acid |
| SMILES | COc1cc2sc(C(=O)O)c(OCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C18H16O5S/c1-21-13-8-12-15(9-14(13)22-2)24-17(18(19)20)16(12)23-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | IZTNXPQUTWNESS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |