C22H40N4O5 — CID 14674574
(2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-5-piperidin-4-ylpentyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 14674574) has the molecular formula C22H40N4O5 and a molecular weight of 440.59 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-5-piperidin-4-ylpentyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-5-piperidin-4-ylpentyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14674574 |
| Molecular Formula | C22H40N4O5 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-5-piperidin-4-ylpentyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](N[C@@H](CCCCC1CCNCC1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H40N4O5/c23-12-4-3-7-17(20(27)26-15-5-9-19(26)22(30)31)25-18(21(28)29)8-2-1-6-16-10-13-24-14-11-16/h16-19,24-25H,1-15,23H2,(H,28,29)(H,30,31)/t17-,18-,19-/m0/s1 |
| InChIKey | HCXAPFSPEVBCGR-FHWLQOOXSA-N |
| XLogP | 1.16 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|