C20H36N4O4 — CID 25159800
(2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 25159800) has the molecular formula C20H36N4O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 25159800 |
| Molecular Formula | C20H36N4O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-3-cyclohexyl-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)N[C@H](CC1CCCCC1)C(=O)N1CCCC1)C(=O)O |
| InChI | InChI=1S/C20H36N4O4/c21-11-5-4-10-16(19(26)27)22-20(28)23-17(14-15-8-2-1-3-9-15)18(25)24-12-6-7-13-24/h15-17H,1-14,21H2,(H,26,27)(H2,22,23,28)/t16-,17+/m0/s1 |
| InChIKey | GJAAVXDJHXJNFO-DLBZAZTESA-N |
| XLogP | 1.83 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|