C29H43N5O3 — CID 146763115
2-amino-3-[[4-[[[hydroxy-(3-methoxyanilino)methyl]amino]methyl]phenyl]methyl]-5,5-bis(3-methylbutyl)imidazol-4-one (PubChem CID 146763115) has the molecular formula C29H43N5O3 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-amino-3-[[4-[[[hydroxy-(3-methoxyanilino)methyl]amino]methyl]phenyl]methyl]-5,5-bis(3-methylbutyl)imidazol-4-one.
| Compound Name | 2-amino-3-[[4-[[[hydroxy-(3-methoxyanilino)methyl]amino]methyl]phenyl]methyl]-5,5-bis(3-methylbutyl)imidazol-4-one |
|---|---|
| PubChem CID | 146763115 |
| Molecular Formula | C29H43N5O3 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | 2-amino-3-[[4-[[[hydroxy-(3-methoxyanilino)methyl]amino]methyl]phenyl]methyl]-5,5-bis(3-methylbutyl)imidazol-4-one |
| SMILES | COc1cccc(NC(O)NCc2ccc(CN3C(=O)C(CCC(C)C)(CCC(C)C)N=C3N)cc2)c1 |
| InChI | InChI=1S/C29H43N5O3/c1-20(2)13-15-29(16-14-21(3)4)26(35)34(27(30)33-29)19-23-11-9-22(10-12-23)18-31-28(36)32-24-7-6-8-25(17-24)37-5/h6-12,17,20-21,28,31-32,36H,13-16,18-19H2,1-5H3,(H2,30,33) |
| InChIKey | RPUVLZXHZFLCRV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|