C16H18FN2O2+ — CID 146771473
[[2-fluoro-4-[(4-methoxyphenyl)methylamino]phenyl]-hydroxymethylidene]-methylazanium (PubChem CID 146771473) has the molecular formula C16H18FN2O2+ and a molecular weight of 289.33 g/mol. Its IUPAC name is [[2-fluoro-4-[(4-methoxyphenyl)methylamino]phenyl]-hydroxymethylidene]-methylazanium.
| Compound Name | [[2-fluoro-4-[(4-methoxyphenyl)methylamino]phenyl]-hydroxymethylidene]-methylazanium |
|---|---|
| PubChem CID | 146771473 |
| Molecular Formula | C16H18FN2O2+ |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [[2-fluoro-4-[(4-methoxyphenyl)methylamino]phenyl]-hydroxymethylidene]-methylazanium |
| SMILES | C/[NH+]=C(\O)c1ccc(NCc2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C16H17FN2O2/c1-18-16(20)14-8-5-12(9-15(14)17)19-10-11-3-6-13(21-2)7-4-11/h3-9,19H,10H2,1-2H3,(H,18,20)/p+1 |
| InChIKey | RRSJWQTWKYYLLB-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 55.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|