C24H26F2N4O3 — CID 158982977
4-amino-2-fluoro-N-methylbenzamide;2-fluoro-4-[(4-methoxyphenyl)methylamino]-N-methylbenzamide (PubChem CID 158982977) has the molecular formula C24H26F2N4O3 and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-amino-2-fluoro-N-methylbenzamide;2-fluoro-4-[(4-methoxyphenyl)methylamino]-N-methylbenzamide.
| Compound Name | 4-amino-2-fluoro-N-methylbenzamide;2-fluoro-4-[(4-methoxyphenyl)methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 158982977 |
| Molecular Formula | C24H26F2N4O3 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-amino-2-fluoro-N-methylbenzamide;2-fluoro-4-[(4-methoxyphenyl)methylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)cc1F.CNC(=O)c1ccc(NCc2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C16H17FN2O2.C8H9FN2O/c1-18-16(20)14-8-5-12(9-15(14)17)19-10-11-3-6-13(21-2)7-4-11;1-11-8(12)6-3-2-5(10)4-7(6)9/h3-9,19H,10H2,1-2H3,(H,18,20);2-4H,10H2,1H3,(H,11,12) |
| InChIKey | JPFQHCAJAQGJMQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|