C26H30N3O3S+ — CID 146773470
[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[7-[2-(ethylcarbamoyloxymethyl)phenyl]-1-benzothiophen-2-yl]-hydroxymethylidene]azanium (PubChem CID 146773470) has the molecular formula C26H30N3O3S+ and a molecular weight of 464.61 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[7-[2-(ethylcarbamoyloxymethyl)phenyl]-1-benzothiophen-2-yl]-hydroxymethylidene]azanium.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[7-[2-(ethylcarbamoyloxymethyl)phenyl]-1-benzothiophen-2-yl]-hydroxymethylidene]azanium |
|---|---|
| PubChem CID | 146773470 |
| Molecular Formula | C26H30N3O3S+ |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl]-[[7-[2-(ethylcarbamoyloxymethyl)phenyl]-1-benzothiophen-2-yl]-hydroxymethylidene]azanium |
| SMILES | CCNC(=O)OCc1ccccc1-c1cccc2cc(/C(O)=[NH+]/[C@H]3CN4CCC3CC4)sc12 |
| InChI | InChI=1S/C26H29N3O3S/c1-2-27-26(31)32-16-19-6-3-4-8-20(19)21-9-5-7-18-14-23(33-24(18)21)25(30)28-22-15-29-12-10-17(22)11-13-29/h3-9,14,17,22H,2,10-13,15-16H2,1H3,(H,27,31)(H,28,30)/p+1/t22-/m0/s1 |
| InChIKey | RSEGGIYFUKGNNO-QFIPXVFZSA-O |
| XLogP | 3.29 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|