C29H30FN3O3S — CID 146784906
1-cyclohexyl-5-[4-[2-(1-ethylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]pentane-2,4-dione (PubChem CID 146784906) has the molecular formula C29H30FN3O3S and a molecular weight of 519.64 g/mol. Its IUPAC name is 1-cyclohexyl-5-[4-[2-(1-ethylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]pentane-2,4-dione.
| Compound Name | 1-cyclohexyl-5-[4-[2-(1-ethylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 146784906 |
| Molecular Formula | C29H30FN3O3S |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 1-cyclohexyl-5-[4-[2-(1-ethylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]pentane-2,4-dione |
| SMILES | CCn1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)CC5CCCCC5)cc4F)c3s2)c1 |
| InChI | InChI=1S/C29H30FN3O3S/c1-2-33-17-25(32-18-33)28-16-24-29(37-28)27(10-11-31-24)36-26-9-8-20(14-23(26)30)13-22(35)15-21(34)12-19-6-4-3-5-7-19/h8-11,14,16-19H,2-7,12-13,15H2,1H3 |
| InChIKey | RUOUEEXJAYXFPV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|