C32H30FN3O5S — CID 161085411
1-[3-fluoro-4-[2-[1-(propoxymethyl)imidazol-4-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione (PubChem CID 161085411) has the molecular formula C32H30FN3O5S and a molecular weight of 587.67 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[1-(propoxymethyl)imidazol-4-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[1-(propoxymethyl)imidazol-4-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 161085411 |
| Molecular Formula | C32H30FN3O5S |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 1-[3-fluoro-4-[2-[1-(propoxymethyl)imidazol-4-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
| SMILES | CCCOCn1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5ccccc5OC)cc4F)c3s2)c1 |
| InChI | InChI=1S/C32H30FN3O5S/c1-3-12-40-20-36-18-27(35-19-36)31-17-26-32(42-31)30(10-11-34-26)41-29-9-8-21(14-25(29)33)13-23(37)16-24(38)15-22-6-4-5-7-28(22)39-2/h4-11,14,17-19H,3,12-13,15-16,20H2,1-2H3 |
| InChIKey | YODUYSCOLDQSGX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|