C35H33FN2O5S — CID 158930925
1-[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione (PubChem CID 158930925) has the molecular formula C35H33FN2O5S and a molecular weight of 612.72 g/mol. Its IUPAC name is 1-[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione.
| Compound Name | 1-[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 158930925 |
| Molecular Formula | C35H33FN2O5S |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 1-[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-5-(2-methoxyphenyl)pentane-2,4-dione |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)Cc5ccccc5OC)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C35H33FN2O5S/c1-41-16-15-37-22-23-7-10-25(11-8-23)34-21-30-35(44-34)33(13-14-38-30)43-32-12-9-24(18-29(32)36)17-27(39)20-28(40)19-26-5-3-4-6-31(26)42-2/h3-14,18,21,37H,15-17,19-20,22H2,1-2H3 |
| InChIKey | JJASFCRXYFIUJB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|