C36H33FN2O5S2 — CID 158172986
1-[1-[2-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone (PubChem CID 158172986) has the molecular formula C36H33FN2O5S2 and a molecular weight of 656.80 g/mol. Its IUPAC name is 1-[1-[2-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone.
| Compound Name | 1-[1-[2-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone |
|---|---|
| PubChem CID | 158172986 |
| Molecular Formula | C36H33FN2O5S2 |
| Molecular Weight | 656.80 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 1-[1-[2-[3-fluoro-4-[2-[4-[(2-methylsulfonylethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)C5(C(=O)Cc6ccccc6)CC5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C36H33FN2O5S2/c1-46(42,43)18-17-38-23-25-7-10-27(11-8-25)32-22-29-35(45-32)31(13-16-39-29)44-30-12-9-26(19-28(30)37)21-34(41)36(14-15-36)33(40)20-24-5-3-2-4-6-24/h2-13,16,19,22,38H,14-15,17-18,20-21,23H2,1H3 |
| InChIKey | FXRKJIOWMXACHV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|