C34H31FN2O4S3 — CID 158588668
5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one;sulfur dioxide (PubChem CID 158588668) has the molecular formula C34H31FN2O4S3 and a molecular weight of 646.83 g/mol. Its IUPAC name is 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one;sulfur dioxide.
| Compound Name | 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one;sulfur dioxide |
|---|---|
| PubChem CID | 158588668 |
| Molecular Formula | C34H31FN2O4S3 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one;sulfur dioxide |
| SMILES | CCCNCc1cccc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccccc5)cc4F)c3s2)c1.O=S=O |
| InChI | InChI=1S/C34H31FN2O2S2.O2S/c1-2-14-36-22-25-9-6-10-26(16-25)33-21-30-34(41-33)32(13-15-37-30)39-31-12-11-24(19-29(31)35)18-28(40)20-27(38)17-23-7-4-3-5-8-23;1-3-2/h3-13,15-16,19,21,36H,2,14,17-18,20,22H2,1H3; |
| InChIKey | HUDSALIGOGZHLH-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|