C28H23N3O2S2 — CID 167549652
5-[4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one (PubChem CID 167549652) has the molecular formula C28H23N3O2S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 5-[4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 167549652 |
| Molecular Formula | C28H23N3O2S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 5-[4-[2-(1-methylimidazol-4-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-phenyl-4-sulfanylidenepentan-2-one |
| SMILES | Cn1cnc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccccc5)cc4)c3s2)c1 |
| InChI | InChI=1S/C28H23N3O2S2/c1-31-17-25(30-18-31)27-16-24-28(35-27)26(11-12-29-24)33-22-9-7-20(8-10-22)14-23(34)15-21(32)13-19-5-3-2-4-6-19/h2-12,16-18H,13-15H2,1H3 |
| InChIKey | BNOKNGMHDFSBJN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|