C36H32F2N2O4S — CID 152955102
1-[1-[2-[4-[2-[4-[(ethoxymethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 152955102) has the molecular formula C36H32F2N2O4S and a molecular weight of 626.73 g/mol. Its IUPAC name is 1-[1-[2-[4-[2-[4-[(ethoxymethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[4-[2-[4-[(ethoxymethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 152955102 |
| Molecular Formula | C36H32F2N2O4S |
| Molecular Weight | 626.73 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | 1-[1-[2-[4-[2-[4-[(ethoxymethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | CCOCNCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)C5(C(=O)Cc6ccc(F)cc6)CC5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C36H32F2N2O4S/c1-2-43-22-39-21-24-3-8-26(9-4-24)32-20-29-35(45-32)31(13-16-40-29)44-30-12-7-25(17-28(30)38)19-34(42)36(14-15-36)33(41)18-23-5-10-27(37)11-6-23/h3-13,16-17,20,39H,2,14-15,18-19,21-22H2,1H3 |
| InChIKey | UPLUVXZLCAUVGN-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.73 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|