C21H23F5N4O3 — CID 146793385
1-[5-cyclopropyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-4-(3,3-difluoroazetidin-1-yl)-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one (PubChem CID 146793385) has the molecular formula C21H23F5N4O3 and a molecular weight of 474.43 g/mol. Its IUPAC name is 1-[5-cyclopropyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-4-(3,3-difluoroazetidin-1-yl)-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one.
| Compound Name | 1-[5-cyclopropyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-4-(3,3-difluoroazetidin-1-yl)-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 146793385 |
| Molecular Formula | C21H23F5N4O3 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[5-cyclopropyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-4-(3,3-difluoroazetidin-1-yl)-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one |
| SMILES | Cc1nc(C(C)(CC(=O)c2cc(OCC(F)(F)F)c(C3CC3)cn2)CN2CC(F)(F)C2)no1 |
| InChI | InChI=1S/C21H23F5N4O3/c1-12-28-18(29-33-12)19(2,8-30-9-20(22,23)10-30)6-16(31)15-5-17(32-11-21(24,25)26)14(7-27-15)13-3-4-13/h5,7,13H,3-4,6,8-11H2,1-2H3 |
| InChIKey | RWGQSWSFPIBWCX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |