C21H23F5N4O3 — CID 148645593
(3S)-4-cyclopropyl-1-[5-(3,3-difluoroazetidin-1-yl)-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one (PubChem CID 148645593) has the molecular formula C21H23F5N4O3 and a molecular weight of 474.43 g/mol. Its IUPAC name is (3S)-4-cyclopropyl-1-[5-(3,3-difluoroazetidin-1-yl)-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one.
| Compound Name | (3S)-4-cyclopropyl-1-[5-(3,3-difluoroazetidin-1-yl)-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 148645593 |
| Molecular Formula | C21H23F5N4O3 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (3S)-4-cyclopropyl-1-[5-(3,3-difluoroazetidin-1-yl)-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]-3-methyl-3-(5-methyl-1,2,4-oxadiazol-3-yl)butan-1-one |
| SMILES | Cc1nc([C@](C)(CC(=O)c2cc(OCC(F)(F)F)c(N3CC(F)(F)C3)cn2)CC2CC2)no1 |
| InChI | InChI=1S/C21H23F5N4O3/c1-12-28-18(29-33-12)19(2,6-13-3-4-13)7-16(31)14-5-17(32-11-21(24,25)26)15(8-27-14)30-9-20(22,23)10-30/h5,8,13H,3-4,6-7,9-11H2,1-2H3/t19-/m0/s1 |
| InChIKey | NKWRXGLRTYFBLI-IBGZPJMESA-N |
| XLogP | 4.50 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |