C13H22N2O — CID 146798510
(5Z)-2-tert-butyl-5-(2,2-dimethylpropylidene)-3-methylimidazol-4-one (PubChem CID 146798510) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (5Z)-2-tert-butyl-5-(2,2-dimethylpropylidene)-3-methylimidazol-4-one.
| Compound Name | (5Z)-2-tert-butyl-5-(2,2-dimethylpropylidene)-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 146798510 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (5Z)-2-tert-butyl-5-(2,2-dimethylpropylidene)-3-methylimidazol-4-one |
| SMILES | CN1C(=O)/C(=C/C(C)(C)C)N=C1C(C)(C)C |
| InChI | InChI=1S/C13H22N2O/c1-12(2,3)8-9-10(16)15(7)11(14-9)13(4,5)6/h8H,1-7H3/b9-8- |
| InChIKey | RXIPGKCSUMAXIJ-HJWRWDBZSA-N |
| XLogP | 2.83 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|