C9H16N2O — CID 145445213
ethane;(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one (PubChem CID 145445213) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is ethane;(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one.
| Compound Name | ethane;(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one |
|---|---|
| PubChem CID | 145445213 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | ethane;(5Z)-5-ethylidene-2,3-dimethylimidazol-4-one |
| SMILES | C/C=C1\N=C(C)N(C)C1=O.CC |
| InChI | InChI=1S/C7H10N2O.C2H6/c1-4-6-7(10)9(3)5(2)8-6;1-2/h4H,1-3H3;1-2H3/b6-4-; |
| InChIKey | UUOYUGYZMXCYKL-YHSAGPEESA-N |
| XLogP | 1.81 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|