C25H18FN2OS+ — CID 146815707
4-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium (PubChem CID 146815707) has the molecular formula C25H18FN2OS+ and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium.
| Compound Name | 4-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
|---|---|
| PubChem CID | 146815707 |
| Molecular Formula | C25H18FN2OS+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-(7-fluoro-2,3-dimethyldibenzofuran-4-yl)-3-methyl-[1]benzothiolo[3,2-d]pyrimidin-3-ium |
| SMILES | Cc1cc2c(oc3cc(F)ccc32)c(-c2c3sc4ccccc4c3nc[n+]2C)c1C |
| InChI | InChI=1S/C25H18FN2OS/c1-13-10-18-16-9-8-15(26)11-19(16)29-24(18)21(14(13)2)23-25-22(27-12-28(23)3)17-6-4-5-7-20(17)30-25/h4-12H,1-3H3/q+1 |
| InChIKey | YNFFZLZSWIZJRX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|