About CID 146816800
CID 146816800 (PubChem CID 146816800) has the molecular formula C24H15BClO2
and a molecular weight of 381.65 g/mol.
Molecular Properties
| Compound Name | CID 146816800 |
| PubChem CID | 146816800 |
| Molecular Formula | C24H15BClO2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | — |
| SMILES | O[B]c1ccc(Cl)c2c1oc1c(-c3ccccc3)cc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C24H15BClO2/c26-21-12-11-20(25-27)24-22(21)19-14-17(15-7-3-1-4-8-15)13-18(23(19)28-24)16-9-5-2-6-10-16/h1-14,27H |
| InChIKey | GYSVVTAKGKGCLI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 146816800 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146816800?
The IUPAC name of CID 146816800 (CID 146816800) is not available.
What is the SMILES notation for CID 146816800?
The canonical SMILES for CID 146816800 is O[B]c1ccc(Cl)c2c1oc1c(-c3ccccc3)cc(-c3ccccc3)cc12.
What is the InChIKey of CID 146816800?
The InChIKey is GYSVVTAKGKGCLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15BClO2/c26-21-12-11-20(25-27)24-22(21)19-14-17(15-7-3-1-4-8-15)13-18(23(19)28-24)16-9-5-2-6-10-16/h1-14,27H.
What are the key properties of CID 146816800?
CID 146816800 has a molecular weight of 381.65 g/mol, XLogP of 5.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146816800 is sourced from PubChem (CID 146816800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).