C31H21NO — CID 153340539
(4,6,8-triphenyldibenzofuran-1-yl)methanimine (PubChem CID 153340539) has the molecular formula C31H21NO and a molecular weight of 423.52 g/mol. Its IUPAC name is (4,6,8-triphenyldibenzofuran-1-yl)methanimine.
| Compound Name | (4,6,8-triphenyldibenzofuran-1-yl)methanimine |
|---|---|
| PubChem CID | 153340539 |
| Molecular Formula | C31H21NO |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (4,6,8-triphenyldibenzofuran-1-yl)methanimine |
| SMILES | [H]/N=C/c1ccc(-c2ccccc2)c2oc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C31H21NO/c32-20-24-16-17-26(22-12-6-2-7-13-22)31-29(24)28-19-25(21-10-4-1-5-11-21)18-27(30(28)33-31)23-14-8-3-9-15-23/h1-20,32H/b32-20+ |
| InChIKey | YGPRDVRQXUFIMI-UZWMFBFFSA-N |
| XLogP | 8.58 |
| TPSA | 36.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|