C39H26N2O — CID 153340661
4-phenanthren-9-yl-6,8-diphenyldibenzofuran-1-carboximidamide (PubChem CID 153340661) has the molecular formula C39H26N2O and a molecular weight of 538.65 g/mol. Its IUPAC name is 4-phenanthren-9-yl-6,8-diphenyldibenzofuran-1-carboximidamide.
| Compound Name | 4-phenanthren-9-yl-6,8-diphenyldibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 153340661 |
| Molecular Formula | C39H26N2O |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 4-phenanthren-9-yl-6,8-diphenyldibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc3ccccc3c3ccccc23)c2oc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C39H26N2O/c40-39(41)32-20-19-31(34-21-26-15-7-8-16-28(26)29-17-9-10-18-30(29)34)38-36(32)35-23-27(24-11-3-1-4-12-24)22-33(37(35)42-38)25-13-5-2-6-14-25/h1-23H,(H3,40,41) |
| InChIKey | VULBFWRAVMQIKY-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 63.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|