C37H24N2O2 — CID 153340631
4-dibenzofuran-4-yl-6,8-diphenyldibenzofuran-1-carboximidamide (PubChem CID 153340631) has the molecular formula C37H24N2O2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 4-dibenzofuran-4-yl-6,8-diphenyldibenzofuran-1-carboximidamide.
| Compound Name | 4-dibenzofuran-4-yl-6,8-diphenyldibenzofuran-1-carboximidamide |
|---|---|
| PubChem CID | 153340631 |
| Molecular Formula | C37H24N2O2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 4-dibenzofuran-4-yl-6,8-diphenyldibenzofuran-1-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cccc3c2oc2ccccc23)c2oc3c(-c4ccccc4)cc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C37H24N2O2/c38-37(39)29-19-18-28(27-16-9-15-26-25-14-7-8-17-32(25)40-34(26)27)36-33(29)31-21-24(22-10-3-1-4-11-22)20-30(35(31)41-36)23-12-5-2-6-13-23/h1-21H,(H3,38,39) |
| InChIKey | ZWYNZYUTIIYWCB-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|