C48H34N4O2 — CID 146856580
5-[5-[10-[10-[5-(2,4-dimethyl-1,3-oxazol-5-yl)-2-pyridinyl]anthracen-9-yl]anthracen-9-yl]-2-pyridinyl]-2,4-dimethyl-1,3-oxazole (PubChem CID 146856580) has the molecular formula C48H34N4O2 and a molecular weight of 698.83 g/mol. Its IUPAC name is 5-[5-[10-[10-[5-(2,4-dimethyl-1,3-oxazol-5-yl)-2-pyridinyl]anthracen-9-yl]anthracen-9-yl]-2-pyridinyl]-2,4-dimethyl-1,3-oxazole.
| Compound Name | 5-[5-[10-[10-[5-(2,4-dimethyl-1,3-oxazol-5-yl)-2-pyridinyl]anthracen-9-yl]anthracen-9-yl]-2-pyridinyl]-2,4-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 146856580 |
| Molecular Formula | C48H34N4O2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | 5-[5-[10-[10-[5-(2,4-dimethyl-1,3-oxazol-5-yl)-2-pyridinyl]anthracen-9-yl]anthracen-9-yl]-2-pyridinyl]-2,4-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(C)c(-c2ccc(-c3c4ccccc4c(-c4c5ccccc5c(-c5ccc(-c6oc(C)nc6C)nc5)c5ccccc45)c4ccccc34)nc2)o1 |
| InChI | InChI=1S/C48H34N4O2/c1-27-47(53-29(3)51-27)32-22-23-41(49-26-32)44-35-15-7-11-19-39(35)46(40-20-12-8-16-36(40)44)45-37-17-9-5-13-33(37)43(34-14-6-10-18-38(34)45)31-21-24-42(50-25-31)48-28(2)52-30(4)54-48/h5-26H,1-4H3 |
| InChIKey | SJSGOFFNKVOXBR-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|