C18H11F4N — CID 58224566
2-phenyl-5-(2,3,4,5-tetrafluoro-6-methylphenyl)pyridine (PubChem CID 58224566) has the molecular formula C18H11F4N and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-phenyl-5-(2,3,4,5-tetrafluoro-6-methylphenyl)pyridine.
| Compound Name | 2-phenyl-5-(2,3,4,5-tetrafluoro-6-methylphenyl)pyridine |
|---|---|
| PubChem CID | 58224566 |
| Molecular Formula | C18H11F4N |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-phenyl-5-(2,3,4,5-tetrafluoro-6-methylphenyl)pyridine |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1-c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C18H11F4N/c1-10-14(16(20)18(22)17(21)15(10)19)12-7-8-13(23-9-12)11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | AFVBJPKAPAMEOI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|