About 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile
3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile (PubChem CID 14686422) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile.
Analyze 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile?
The IUPAC name of 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile (CID 14686422) is 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile.
What is the SMILES notation for 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile?
The canonical SMILES for 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile is N#Cc1nc2c([nH]c1=O)CCCC2.
What is the InChIKey of 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile?
The InChIKey is INPNEBUTEXPDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c10-5-8-9(13)12-7-4-2-1-3-6(7)11-8/h1-4H2,(H,12,13).
What are the key properties of 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile?
3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile has a molecular weight of 175.19 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-5,6,7,8-tetrahydro-4H-quinoxaline-2-carbonitrile is sourced from PubChem (CID 14686422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).