About 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine
1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine (PubChem CID 39101052) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine.
Analyze 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine?
The IUPAC name of 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine (CID 39101052) is 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine.
What is the SMILES notation for 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine?
The canonical SMILES for 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine is Nc1nc2c([nH]1)CCC2.
What is the InChIKey of 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine?
The InChIKey is UIGCVNXVDVSUTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c7-6-8-4-2-1-3-5(4)9-6/h1-3H2,(H3,7,8,9).
What are the key properties of 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine?
1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine has a molecular weight of 123.16 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5,6-tetrahydrocyclopenta[d]imidazol-2-amine is sourced from PubChem (CID 39101052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).