C23H31IO4S — CID 14686516
[[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-lambda3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 14686516) has the molecular formula C23H31IO4S and a molecular weight of 530.47 g/mol. Its IUPAC name is [[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-lambda3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-lambda3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14686516 |
| Molecular Formula | C23H31IO4S |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | [[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-phenyl-lambda3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OI(O[C@H]2C[C@@H](C)CC[C@@H]2C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H31IO4S/c1-17(2)22-15-12-19(4)16-23(22)27-24(20-8-6-5-7-9-20)28-29(25,26)21-13-10-18(3)11-14-21/h5-11,13-14,17,19,22-23H,12,15-16H2,1-4H3/t19-,22+,23-/m0/s1 |
| InChIKey | HINQJNHGIBWAJS-PMOQBDJRSA-N |
| XLogP | 6.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|