C18H14F3N3O2 — CID 146885562
2-[5-(2-methyloxiran-2-yl)-1,3,4-oxadiazol-2-yl]-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 146885562) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-[5-(2-methyloxiran-2-yl)-1,3,4-oxadiazol-2-yl]-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-[5-(2-methyloxiran-2-yl)-1,3,4-oxadiazol-2-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 146885562 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[5-(2-methyloxiran-2-yl)-1,3,4-oxadiazol-2-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CC1(c2nnc(-c3ccccc3Nc3ccc(C(F)(F)F)cc3)o2)CO1 |
| InChI | InChI=1S/C18H14F3N3O2/c1-17(10-25-17)16-24-23-15(26-16)13-4-2-3-5-14(13)22-12-8-6-11(7-9-12)18(19,20)21/h2-9,22H,10H2,1H3 |
| InChIKey | SVSQTUOPINUQDX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|