C19H16F3N5O — CID 147374188
methyl-[1-[5-[2-[4-(trifluoromethyl)anilino]phenyl]-1,3,4-oxadiazol-2-yl]ethyl]cyanamide (PubChem CID 147374188) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is methyl-[1-[5-[2-[4-(trifluoromethyl)anilino]phenyl]-1,3,4-oxadiazol-2-yl]ethyl]cyanamide.
| Compound Name | methyl-[1-[5-[2-[4-(trifluoromethyl)anilino]phenyl]-1,3,4-oxadiazol-2-yl]ethyl]cyanamide |
|---|---|
| PubChem CID | 147374188 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl-[1-[5-[2-[4-(trifluoromethyl)anilino]phenyl]-1,3,4-oxadiazol-2-yl]ethyl]cyanamide |
| SMILES | CC(c1nnc(-c2ccccc2Nc2ccc(C(F)(F)F)cc2)o1)N(C)C#N |
| InChI | InChI=1S/C19H16F3N5O/c1-12(27(2)11-23)17-25-26-18(28-17)15-5-3-4-6-16(15)24-14-9-7-13(8-10-14)19(20,21)22/h3-10,12,24H,1-2H3 |
| InChIKey | DJRQHQROTHXEPB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|