C12H15NO — CID 146896
1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine N-oxide (PubChem CID 146896) has the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-methyl-1-oxido-4-phenyl-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | 1-Methyl-4-phenyl-1,2,3,6-tetrahydropyridine N-oxide |
|---|---|
| PubChem CID | 146896 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-methyl-1-oxido-4-phenyl-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | C[N+]1(CCC(=CC1)C2=CC=CC=C2)[O-] |
| InChI | InChI=1S/C12H15NO/c1-13(14)9-7-12(8-10-13)11-5-3-2-4-6-11/h2-7H,8-10H2,1H3 |
| InChIKey | FZVSMNOAJGWONA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 18.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 230 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|