C60H41N11O — CID 146896773
9-[3-(3-dibenzofuran-2-yl-4-pyridinyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 146896773) has the molecular formula C60H41N11O and a molecular weight of 932.06 g/mol. Its IUPAC name is 9-[3-(3-dibenzofuran-2-yl-4-pyridinyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-[3-(3-dibenzofuran-2-yl-4-pyridinyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 146896773 |
| Molecular Formula | C60H41N11O |
| Molecular Weight | 932.06 g/mol |
| Exact Mass | 931.35 |
| IUPAC Name | 9-[3-(3-dibenzofuran-2-yl-4-pyridinyl)-4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c(-c3ccncc3-c3ccc4oc5ccccc5c4c3)c2)n1 |
| InChI | InChI=1S/C60H41N11O/c1-34-62-35(2)65-58(64-34)41-19-24-52-48(30-41)49-31-42(59-66-36(3)63-37(4)67-59)20-25-53(49)71(52)43-22-23-46(60-69-56(38-13-7-5-8-14-38)68-57(70-60)39-15-9-6-10-16-39)47(32-43)44-27-28-61-33-51(44)40-21-26-55-50(29-40)45-17-11-12-18-54(45)72-55/h5-33H,1-4H3 |
| InChIKey | UCLZMJYQIOMCDR-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 146.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.06 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |