C43H30N8 — CID 138578689
3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole (PubChem CID 138578689) has the molecular formula C43H30N8 and a molecular weight of 658.77 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole.
| Compound Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
|---|---|
| PubChem CID | 138578689 |
| Molecular Formula | C43H30N8 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-pyridin-2-ylphenyl]carbazole |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3ccccn3)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C43H30N8/c1-27-45-28(2)47-42(46-27)31-20-23-39-35(25-31)34-17-9-10-19-38(34)51(39)32-21-22-33(37-18-11-12-24-44-37)36(26-32)43-49-40(29-13-5-3-6-14-29)48-41(50-43)30-15-7-4-8-16-30/h3-26H,1-2H3 |
| InChIKey | DIFPJWBYBOYZMK-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |