C15H26O3Si — CID 14689917
2-butyl-4-hydroxy-3-methoxy-4-(3-trimethylsilylprop-1-en-2-yl)cyclobut-2-en-1-one (PubChem CID 14689917) has the molecular formula C15H26O3Si and a molecular weight of 282.46 g/mol. Its IUPAC name is 2-butyl-4-hydroxy-3-methoxy-4-(3-trimethylsilylprop-1-en-2-yl)cyclobut-2-en-1-one.
| Compound Name | 2-butyl-4-hydroxy-3-methoxy-4-(3-trimethylsilylprop-1-en-2-yl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 14689917 |
| Molecular Formula | C15H26O3Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-butyl-4-hydroxy-3-methoxy-4-(3-trimethylsilylprop-1-en-2-yl)cyclobut-2-en-1-one |
| SMILES | C=C(C[Si](C)(C)C)C1(O)C(=O)C(CCCC)=C1OC |
| InChI | InChI=1S/C15H26O3Si/c1-7-8-9-12-13(16)15(17,14(12)18-3)11(2)10-19(4,5)6/h17H,2,7-10H2,1,3-6H3 |
| InChIKey | XSELEKUYFXWDHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|