C12H20O3 — CID 10987581
2-butyl-4-hydroxy-4-methyl-3-propan-2-yloxycyclobut-2-en-1-one (PubChem CID 10987581) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-butyl-4-hydroxy-4-methyl-3-propan-2-yloxycyclobut-2-en-1-one.
| Compound Name | 2-butyl-4-hydroxy-4-methyl-3-propan-2-yloxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10987581 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-butyl-4-hydroxy-4-methyl-3-propan-2-yloxycyclobut-2-en-1-one |
| SMILES | CCCCC1=C(OC(C)C)C(C)(O)C1=O |
| InChI | InChI=1S/C12H20O3/c1-5-6-7-9-10(13)12(4,14)11(9)15-8(2)3/h8,14H,5-7H2,1-4H3 |
| InChIKey | DJKCPHXJAWMHEX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |