C44H48BNO — CID 146922040
4,18-ditert-butyl-14-[4-tert-butyl-2-(2,4-dimethylphenyl)phenyl]-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 146922040) has the molecular formula C44H48BNO and a molecular weight of 617.69 g/mol. Its IUPAC name is 4,18-ditert-butyl-14-[4-tert-butyl-2-(2,4-dimethylphenyl)phenyl]-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 4,18-ditert-butyl-14-[4-tert-butyl-2-(2,4-dimethylphenyl)phenyl]-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 146922040 |
| Molecular Formula | C44H48BNO |
| Molecular Weight | 617.69 g/mol |
| Exact Mass | 617.38 |
| IUPAC Name | 4,18-ditert-butyl-14-[4-tert-butyl-2-(2,4-dimethylphenyl)phenyl]-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)ccc2N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4Oc4cccc2c43)c(C)c1 |
| InChI | InChI=1S/C44H48BNO/c1-27-15-19-32(28(2)23-27)33-24-29(42(3,4)5)16-20-36(33)46-37-21-17-30(43(6,7)8)25-34(37)45-35-26-31(44(9,10)11)18-22-39(35)47-40-14-12-13-38(46)41(40)45/h12-26H,1-11H3 |
| InChIKey | ADJJBLQYSJSYKO-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.69 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|