C30H35N7O — CID 146922635
1-methyl-N-[6-(1-methyl-3-pentylindazol-6-yl)-2-morpholin-4-ylpyrimidin-4-yl]indol-6-amine (PubChem CID 146922635) has the molecular formula C30H35N7O and a molecular weight of 509.66 g/mol. Its IUPAC name is 1-methyl-N-[6-(1-methyl-3-pentylindazol-6-yl)-2-morpholin-4-ylpyrimidin-4-yl]indol-6-amine.
| Compound Name | 1-methyl-N-[6-(1-methyl-3-pentylindazol-6-yl)-2-morpholin-4-ylpyrimidin-4-yl]indol-6-amine |
|---|---|
| PubChem CID | 146922635 |
| Molecular Formula | C30H35N7O |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | 1-methyl-N-[6-(1-methyl-3-pentylindazol-6-yl)-2-morpholin-4-ylpyrimidin-4-yl]indol-6-amine |
| SMILES | CCCCCc1nn(C)c2cc(-c3cc(Nc4ccc5ccn(C)c5c4)nc(N4CCOCC4)n3)ccc12 |
| InChI | InChI=1S/C30H35N7O/c1-4-5-6-7-25-24-11-9-22(18-28(24)36(3)34-25)26-20-29(33-30(32-26)37-14-16-38-17-15-37)31-23-10-8-21-12-13-35(2)27(21)19-23/h8-13,18-20H,4-7,14-17H2,1-3H3,(H,31,32,33) |
| InChIKey | ADMCQNHPHFQTNN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|