C17H18ClN5O — CID 121275852
4-[4-chloro-6-(1,3-dimethylindazol-6-yl)pyrimidin-2-yl]morpholine (PubChem CID 121275852) has the molecular formula C17H18ClN5O and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-[4-chloro-6-(1,3-dimethylindazol-6-yl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-chloro-6-(1,3-dimethylindazol-6-yl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 121275852 |
| Molecular Formula | C17H18ClN5O |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[4-chloro-6-(1,3-dimethylindazol-6-yl)pyrimidin-2-yl]morpholine |
| SMILES | Cc1nn(C)c2cc(-c3cc(Cl)nc(N4CCOCC4)n3)ccc12 |
| InChI | InChI=1S/C17H18ClN5O/c1-11-13-4-3-12(9-15(13)22(2)21-11)14-10-16(18)20-17(19-14)23-5-7-24-8-6-23/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | VEEFIXGCTHIGND-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |