C16H17F2N3O — CID 2992799
4-[4-(difluoromethyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine (PubChem CID 2992799) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-(difluoromethyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 2992799 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[4-(difluoromethyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine |
| SMILES | Cc1ccc(-c2cc(C(F)F)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H17F2N3O/c1-11-2-4-12(5-3-11)13-10-14(15(17)18)20-16(19-13)21-6-8-22-9-7-21/h2-5,10,15H,6-9H2,1H3 |
| InChIKey | ONNUGUUHIJYFMV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |