C23H25N3O3 — CID 1338553
4-[4-(2,4-dimethoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine (PubChem CID 1338553) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-[4-(2,4-dimethoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-(2,4-dimethoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 1338553 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-[4-(2,4-dimethoxyphenyl)-6-(4-methylphenyl)pyrimidin-2-yl]morpholine |
| SMILES | COc1ccc(-c2cc(-c3ccc(C)cc3)nc(N3CCOCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-16-4-6-17(7-5-16)20-15-21(19-9-8-18(27-2)14-22(19)28-3)25-23(24-20)26-10-12-29-13-11-26/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | GTQUGGMCLKGFIL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |