C15H18ClFN4O — CID 82022744
[6-(4-fluorophenyl)-2-morpholin-4-ylpyrimidin-4-yl]methanamine;hydrochloride (PubChem CID 82022744) has the molecular formula C15H18ClFN4O and a molecular weight of 324.79 g/mol. Its IUPAC name is [6-(4-fluorophenyl)-2-morpholin-4-ylpyrimidin-4-yl]methanamine;hydrochloride.
| Compound Name | [6-(4-fluorophenyl)-2-morpholin-4-ylpyrimidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 82022744 |
| Molecular Formula | C15H18ClFN4O |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [6-(4-fluorophenyl)-2-morpholin-4-ylpyrimidin-4-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(-c2ccc(F)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H17FN4O.ClH/c16-12-3-1-11(2-4-12)14-9-13(10-17)18-15(19-14)20-5-7-21-8-6-20;/h1-4,9H,5-8,10,17H2;1H |
| InChIKey | JVALPEHQJFDJCS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |