C17H21FN4 — CID 28904578
[2-(azepan-1-yl)-6-(4-fluorophenyl)pyrimidin-4-yl]methanamine (PubChem CID 28904578) has the molecular formula C17H21FN4 and a molecular weight of 300.38 g/mol. Its IUPAC name is [2-(azepan-1-yl)-6-(4-fluorophenyl)pyrimidin-4-yl]methanamine.
| Compound Name | [2-(azepan-1-yl)-6-(4-fluorophenyl)pyrimidin-4-yl]methanamine |
|---|---|
| PubChem CID | 28904578 |
| Molecular Formula | C17H21FN4 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [2-(azepan-1-yl)-6-(4-fluorophenyl)pyrimidin-4-yl]methanamine |
| SMILES | NCc1cc(-c2ccc(F)cc2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C17H21FN4/c18-14-7-5-13(6-8-14)16-11-15(12-19)20-17(21-16)22-9-3-1-2-4-10-22/h5-8,11H,1-4,9-10,12,19H2 |
| InChIKey | GHSHDRPIYLEFPB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |