C15H18Cl2N4 — CID 82022749
[6-(4-chlorophenyl)-2-pyrrolidin-1-ylpyrimidin-4-yl]methanamine;hydrochloride (PubChem CID 82022749) has the molecular formula C15H18Cl2N4 and a molecular weight of 325.24 g/mol. Its IUPAC name is [6-(4-chlorophenyl)-2-pyrrolidin-1-ylpyrimidin-4-yl]methanamine;hydrochloride.
| Compound Name | [6-(4-chlorophenyl)-2-pyrrolidin-1-ylpyrimidin-4-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 82022749 |
| Molecular Formula | C15H18Cl2N4 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [6-(4-chlorophenyl)-2-pyrrolidin-1-ylpyrimidin-4-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(-c2ccc(Cl)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H17ClN4.ClH/c16-12-5-3-11(4-6-12)14-9-13(10-17)18-15(19-14)20-7-1-2-8-20;/h3-6,9H,1-2,7-8,10,17H2;1H |
| InChIKey | ZUIAXROTASIUKD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |