C24H24N4O4S — CID 146926446
N-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]methylidene]methanesulfonamide (PubChem CID 146926446) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]methylidene]methanesulfonamide.
| Compound Name | N-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]methylidene]methanesulfonamide |
|---|---|
| PubChem CID | 146926446 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[[5-[5-(3-cyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]methylidene]methanesulfonamide |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCCC4C=NS(C)(=O)=O)no2)cc1C#N |
| InChI | InChI=1S/C24H24N4O4S/c1-15(2)31-22-11-10-16(12-18(22)13-25)24-27-23(28-32-24)21-9-5-7-19-17(6-4-8-20(19)21)14-26-33(3,29)30/h5,7,9-12,14-15,17H,4,6,8H2,1-3H3 |
| InChIKey | AEDZQDNJEXSMGR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 118.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|