C24H42O4Si — CID 14693894
methyl (2S)-2-(tert-butyl-methoxy-phenylsilyl)oxydodecanoate (PubChem CID 14693894) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is methyl (2S)-2-(tert-butyl-methoxy-phenylsilyl)oxydodecanoate.
| Compound Name | methyl (2S)-2-(tert-butyl-methoxy-phenylsilyl)oxydodecanoate |
|---|---|
| PubChem CID | 14693894 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | methyl (2S)-2-(tert-butyl-methoxy-phenylsilyl)oxydodecanoate |
| SMILES | CCCCCCCCCC[C@H](O[Si](OC)(c1ccccc1)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C24H42O4Si/c1-7-8-9-10-11-12-13-17-20-22(23(25)26-5)28-29(27-6,24(2,3)4)21-18-15-14-16-19-21/h14-16,18-19,22H,7-13,17,20H2,1-6H3/t22-,29?/m0/s1 |
| InChIKey | YWPHLOITKCINSA-RBQQCVMASA-N |
| XLogP | 5.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|